Products 957060-99-0

CAS 957060-99-0 is the registry number for 3-Borono-N-(2,3-dimethylphenyl)benzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 500g, 1g.

Structural formula: {0} (CAS {1})

[3-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid (CAS 957060-99-0) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [3-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: YOBXXJGRRIXVDU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16BNO3
Molecular weight269.11 g/mol
IUPAC name[3-[(2,3-dimethylphenyl)carbamoyl]phenyl]boronic acid
InChIKeyYOBXXJGRRIXVDU-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)NC2=CC=CC(=C2C)C)(O)O

Computed by PubChem (NCBI)