cas: 957061-00-6 — see every product listed under this CAS number, including other names
(3-((2,5-Dimethylphenyl)carbamoyl)phenyl)boronic acid, 95% (CAS 957061-00-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696292-1G |
| cas | 957061-00-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1445.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[3-[(2,5-dimethylphenyl)carbamoyl]phenyl]boronic acid (CAS 957061-00-6) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [3-[(2,5-dimethylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: VXKQWIGNLAJBGU-UHFFFAOYSA-N.
| Molecular formula | C15H16BNO3 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | [3-[(2,5-dimethylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | VXKQWIGNLAJBGU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=C(C=CC(=C2)C)C)(O)O |
Computed by PubChem (NCBI)