cas: 22071-24-5 — see every product listed under this CAS number, including other names
(3-(Bromomethyl)phenyl)(phenyl)methanone, 95% (CAS 22071-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242411-1G |
| cas | 22071-24-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 565.44 Pln | |
| Fluorochem | 25g | 1705.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[3-(bromomethyl)phenyl]-phenylmethanone (CAS 22071-24-5) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: [3-(bromomethyl)phenyl]-phenylmethanone. InChIKey: SZJQXQICJDHRJE-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | [3-(bromomethyl)phenyl]-phenylmethanone |
| InChIKey | SZJQXQICJDHRJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)CBr |
Computed by PubChem (NCBI)