CAS 22071-24-5 appears in our catalog under these names: [3-(Bromomethyl)phenyl](phenyl)methanone, 98%, 3-Benzoylbenzyl Bromide, >95% (HPLC), (3-(Bromomethyl)phenyl)(phenyl)methanone, 95%. Offered by: Combi-blocks, TRC, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 100mg.
[3-(bromomethyl)phenyl]-phenylmethanone (CAS 22071-24-5) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: [3-(bromomethyl)phenyl]-phenylmethanone. InChIKey: SZJQXQICJDHRJE-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | [3-(bromomethyl)phenyl]-phenylmethanone |
| InChIKey | SZJQXQICJDHRJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC(=C2)CBr |
Computed by PubChem (NCBI)