cas: 2088638-48-4 — see every product listed under this CAS number, including other names
(3-(Hydroxymethyl)-5-(trifluoromethyl)phenyl)boronic acid, 98% (CAS 2088638-48-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1501236-25g |
| cas | 2088638-48-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 37137.94 Pln | |
| AmBeed | 5g | 11156.53 Pln | |
| AmBeed | 10g | 18942.49 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]boronic acid (CAS 2088638-48-4) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: SHVUAYRUNPNLBS-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SHVUAYRUNPNLBS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(F)(F)F)CO)(O)O |
Computed by PubChem (NCBI)