cas: 850568-39-7 — see every product listed under this CAS number, including other names
(3-(Methylsulfonamidomethyl)phenyl)boronic acid, 97% (CAS 850568-39-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211367-100MG |
| cas | 850568-39-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 695.61 Pln | |
| Fluorochem | 5g | 2689.70 Pln | |
| Fluorochem | 10g | 5318.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-(methanesulfonamidomethyl)phenyl]boronic acid (CAS 850568-39-7) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: [3-(methanesulfonamidomethyl)phenyl]boronic acid. InChIKey: FJSWJJOLFPIDER-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | [3-(methanesulfonamidomethyl)phenyl]boronic acid |
| InChIKey | FJSWJJOLFPIDER-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CNS(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)