CAS 486422-59-7 appears in our catalog under these names: 4–(N,N–Dimethylsulfamoyl)phenylboronic acid, N,N-Dimethyl 4-boronobenzenesulfonamide, 4-(N,N-Dimethylsulfamoyl)phenylboronic acid 95%, 4-(N,N-Dimethylsulfamoyl)phenylboronic acid, 98%, 98%, 4-(N,N-Dimethylsulfamoyl)phenylboronic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 10g.
[4-(dimethylsulfamoyl)phenyl]boronic acid (CAS 486422-59-7) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: [4-(dimethylsulfamoyl)phenyl]boronic acid. InChIKey: VVUGXBSXXJTVDS-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | [4-(dimethylsulfamoyl)phenyl]boronic acid |
| InChIKey | VVUGXBSXXJTVDS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)