Products 1072945-62-0
CAS 1072945-62-0 appears in our catalog under these names: (4-(Ethylsulfonamido)phenyl)boronic acid 97%, 4-(Ethylsulfonamido)phenylboronic acid, 97%, 97%, (4-(Ethylsulfonamido)phenyl)boronic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
[4-(ethylsulfonylamino)phenyl]boronic acid (CAS 1072945-62-0) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: [4-(ethylsulfonylamino)phenyl]boronic acid. InChIKey: DFGZKFSYJUXPOK-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | [4-(ethylsulfonylamino)phenyl]boronic acid |
| InChIKey | DFGZKFSYJUXPOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NS(=O)(=O)CC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(Ethylsulfonamido)phenyl)boronic acid, 4-(Ethylsulfonamido)phenylboronic acid, [4-(ethylsulfonylamino)phenyl]boronic acid, (4-ethanesulfonamidophenyl)boronic acid, 4-Ethylsulfonylaminophenylboronic acid, (4-(Ethylsulfonamido)phenyl)boronicacid, [4-(Ethanesulfonamido)phenyl]boronic acid, {4-[(Ethanesulfonyl)amino]phenyl}boronic acid, Boronic acid, B-[4-[(ethylsulfonyl)amino]phenyl]-