CAS 351422-72-5 appears in our catalog under these names: (3–(Pyridin–3–yl)phenyl)boronic acid, (3-(Pyridin-3-yl)phenyl)boronic acid, 98%, 98%, (3-(Pyridin-3-yl)phenyl)boronic acid, 97%, (3-(Pyridin-3-yl)phenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 250mg, 1g, 10g.
(3-pyridin-3-ylphenyl)boronic acid (CAS 351422-72-5) is a chemical compound with the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol. IUPAC name: (3-pyridin-3-ylphenyl)boronic acid. InChIKey: SSVQXHWHJJERAP-UHFFFAOYSA-N.
| Molecular formula | C11H10BNO2 |
|---|---|
| Molecular weight | 199.02 g/mol |
| IUPAC name | (3-pyridin-3-ylphenyl)boronic acid |
| InChIKey | SSVQXHWHJJERAP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CN=CC=C2)(O)O |
Computed by PubChem (NCBI)