Products 1257879-76-7
CAS 1257879-76-7 is the registry number for (5-Phenylpyridin-2-yl)boronic acid, 98+%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
(5-phenyl-2-pyridinyl)boronic acid (CAS 1257879-76-7) is a chemical compound with the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol. IUPAC name: (5-phenyl-2-pyridinyl)boronic acid. InChIKey: HVUAHPMCYBPPHJ-UHFFFAOYSA-N.
| Molecular formula | C11H10BNO2 |
|---|---|
| Molecular weight | 199.02 g/mol |
| IUPAC name | (5-phenyl-2-pyridinyl)boronic acid |
| InChIKey | HVUAHPMCYBPPHJ-UHFFFAOYSA-N |
| SMILES | B(C1=NC=C(C=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)