Products 850991-38-7
CAS 850991-38-7 appears in our catalog under these names: 5-Phenyl-3-pyridinyl boronic acid, 95%, (5–Phenylpyridin–3–yl)boronic acid, (5-Phenylpyridin-3-yl)boronic acid 97%, (5-Phenylpyridin-3-yl)boronic acid, 97%, 97%, 5-Phenyl-3-pyridinylboronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 10g.
(5-phenyl-3-pyridinyl)boronic acid (CAS 850991-38-7) is a chemical compound with the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol. IUPAC name: (5-phenyl-3-pyridinyl)boronic acid. InChIKey: FVWWKNZKPWWOCF-UHFFFAOYSA-N.
| Molecular formula | C11H10BNO2 |
|---|---|
| Molecular weight | 199.02 g/mol |
| IUPAC name | (5-phenyl-3-pyridinyl)boronic acid |
| InChIKey | FVWWKNZKPWWOCF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)