Products 1029654-14-5
CAS 1029654-14-5 appears in our catalog under these names: 2-Phenylpyridine-3-boronic acid, 96%, (2-Phenylpyridin-3-yl)boronic acid 96%, 2-Phenylpyridine-3-boronic acid, 96%, 96%, (2-Phenylpyridin-3-yl)boronic acid, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2-phenyl-3-pyridinyl)boronic acid (CAS 1029654-14-5) is a chemical compound with the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol. IUPAC name: (2-phenyl-3-pyridinyl)boronic acid. InChIKey: BHMAGGNQKVLKSV-UHFFFAOYSA-N.
| Molecular formula | C11H10BNO2 |
|---|---|
| Molecular weight | 199.02 g/mol |
| IUPAC name | (2-phenyl-3-pyridinyl)boronic acid |
| InChIKey | BHMAGGNQKVLKSV-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)