CAS 170230-27-0 appears in our catalog under these names: 4-(2-Pyridyl)phenylboronic acid, 98%, (4–(Pyridin–2–yl)phenyl)boronic acid, (4-(Pyridin-2-yl)phenyl)boronic acid 98%, (4-(Pyridin-2-Yl)Phenyl)Boronic Acid, 98%, 98%, (4-(Pyridin-2-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 25mg, 100mg.
(4-pyridin-2-ylphenyl)boronic acid (CAS 170230-27-0) is a chemical compound with the molecular formula C11H10BNO2 and a molecular weight of 199.02 g/mol. IUPAC name: (4-pyridin-2-ylphenyl)boronic acid. InChIKey: BANFGGCAQWUIAJ-UHFFFAOYSA-N.
| Molecular formula | C11H10BNO2 |
|---|---|
| Molecular weight | 199.02 g/mol |
| IUPAC name | (4-pyridin-2-ylphenyl)boronic acid |
| InChIKey | BANFGGCAQWUIAJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=CC=N2)(O)O |
Computed by PubChem (NCBI)