CAS 1224168-35-7 is the registry number for (3-(p-Tolyl)-1,2,4-oxadiazol-5-yl)methanamine hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride (CAS 1224168-35-7) is a chemical compound with the molecular formula C10H12ClN3O and a molecular weight of 225.67 g/mol. IUPAC name: [3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride. InChIKey: JVBQRFHENBQLDG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | [3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methanamine;hydrochloride |
| InChIKey | JVBQRFHENBQLDG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)CN.Cl |
Computed by PubChem (NCBI)