Products 1562188-93-5
CAS 1562188-93-5 is the registry number for (5-Chloro-pyrazin-2-yl)-piperidin-1-yl-methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(5-chloropyrazin-2-yl)-piperidin-1-ylmethanone (CAS 1562188-93-5) is a chemical compound with the molecular formula C10H12ClN3O and a molecular weight of 225.67 g/mol. IUPAC name: (5-chloropyrazin-2-yl)-piperidin-1-ylmethanone. InChIKey: ZPAJANHFTMODKG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | (5-chloropyrazin-2-yl)-piperidin-1-ylmethanone |
| InChIKey | ZPAJANHFTMODKG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=CN=C(C=N2)Cl |
Computed by PubChem (NCBI)