CAS 49837-96-9 appears in our catalog under these names: 4-(Aminomethyl)-2-methylphthalazin-1(2h)-one hydrochloride, 95%, 4-(Aminomethyl)-2-methylphthalazin-1(2H)-one hydrochloride, 98%, 4-(Aminomethyl)-2-methyl-1,2-dihydrophthalazin-1-one hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg, 0,5g.
4-(aminomethyl)-2-methylphthalazin-1-one;hydrochloride (CAS 49837-96-9) is a chemical compound with the molecular formula C10H12ClN3O and a molecular weight of 225.67 g/mol. IUPAC name: 4-(aminomethyl)-2-methylphthalazin-1-one;hydrochloride. InChIKey: UYHYOQLZHHWWTK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 4-(aminomethyl)-2-methylphthalazin-1-one;hydrochloride |
| InChIKey | UYHYOQLZHHWWTK-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2C(=N1)CN.Cl |
Computed by PubChem (NCBI)