CAS 1185304-75-9 appears in our catalog under these names: [2-(3-Phenyl-1,2,4-oxadiazol-5-yl)ethyl]amine hydrochloride, 95%, 2-(3-Phenyl-(1,2,4)oxadiazol-5-yl)-ethylaminehydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride (CAS 1185304-75-9) is a chemical compound with the molecular formula C10H12ClN3O and a molecular weight of 225.67 g/mol. IUPAC name: 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride. InChIKey: HAVZDRYJRKJILX-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)ethanamine;hydrochloride |
| InChIKey | HAVZDRYJRKJILX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)CCN.Cl |
Computed by PubChem (NCBI)