CAS 1025447-42-0 appears in our catalog under these names: 5-(3-Methoxy-phenyl)-2h-pyrazol-3-ylamine hydrochloride, 95%, 3-(3-Methoxyphenyl)-1H-pyrazol-5-amine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-(3-methoxyphenyl)-1H-pyrazol-3-amine;hydrochloride (CAS 1025447-42-0) is a chemical compound with the molecular formula C10H12ClN3O and a molecular weight of 225.67 g/mol. IUPAC name: 5-(3-methoxyphenyl)-1H-pyrazol-3-amine;hydrochloride. InChIKey: IXRIPOUUDUXBOP-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3O |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | IXRIPOUUDUXBOP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=NN2)N.Cl |
Computed by PubChem (NCBI)