cas: 1394119-83-5 — see every product listed under this CAS number, including other names
(3-[(TERT-BUTYLDIMETHYLSILYL)OXY]CYCLOBUTYL)METHANOL, 98% (CAS 1394119-83-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F503911-250MG |
| cas | 1394119-83-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1060.06 Pln | |
| Fluorochem | 5g | 3965.29 Pln | |
| Fluorochem | 10g | 6032.27 Pln | |
| Fluorochem | 25g | 11259.59 Pln | |
| Fluorochem | 50g | 19959.66 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol (CAS 1394119-83-5) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol. InChIKey: QNUGWZOQASOOEE-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol |
| InChIKey | QNUGWZOQASOOEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)CO |
Computed by PubChem (NCBI)