cas: 1394119-83-5 — see every product listed under this CAS number, including other names
{3-[(tert-Butyldimethylsilyl)oxy]cyclobutyl}methanol, 98.0% (CAS 1394119-83-5) is a chemical reagent available from Chemat. Available pack sizes: 500 mg, 100 mg, 1 g, 25 g, 250 mg, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W061103-500 mg |
| cas | 1394119-83-5 |
| size | 500 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 mg | 839.82 Pln | |
| MedChemExpress | 100 mg | 389.35 Pln | |
| MedChemExpress | 1 g | 1215.98 Pln | |
| MedChemExpress | 25 g | 12370.87 Pln | |
| MedChemExpress | 250 mg | 579.76 Pln | |
| MedChemExpress | 5 g | 4415.70 Pln | |
| MedChemExpress | 10 g | 6654.11 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
[3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol (CAS 1394119-83-5) is a chemical compound with the molecular formula C11H24O2Si and a molecular weight of 216.39 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol. InChIKey: QNUGWZOQASOOEE-UHFFFAOYSA-N.
| Molecular formula | C11H24O2Si |
|---|---|
| Molecular weight | 216.39 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]methanol |
| InChIKey | QNUGWZOQASOOEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)CO |
Computed by PubChem (NCBI)