cas: 850198-68-4 — see every product listed under this CAS number, including other names
(3-Acetyl-4-fluorophenyl)boronic acid, 98% (CAS 850198-68-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A596623-10g |
| cas | 850198-68-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12823.09 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 3215.55 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-acetyl-4-fluorophenyl)boronic acid (CAS 850198-68-4) is a chemical compound with the molecular formula C8H8BFO3 and a molecular weight of 181.96 g/mol. IUPAC name: (3-acetyl-4-fluorophenyl)boronic acid. InChIKey: SLTQXKDHZMXMNR-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO3 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | (3-acetyl-4-fluorophenyl)boronic acid |
| InChIKey | SLTQXKDHZMXMNR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)C)(O)O |
Computed by PubChem (NCBI)