Products 481725-35-3
CAS 481725-35-3 is the registry number for 4-Acetyl-3-fluorophenylboronic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(4-acetyl-3-fluorophenyl)boronic acid (CAS 481725-35-3) is a chemical compound with the molecular formula C8H8BFO3 and a molecular weight of 181.96 g/mol. IUPAC name: (4-acetyl-3-fluorophenyl)boronic acid. InChIKey: YHEPWJRNHLTYSL-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO3 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | (4-acetyl-3-fluorophenyl)boronic acid |
| InChIKey | YHEPWJRNHLTYSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Acetyl-3-fluorophenylboronic acid, (4-acetyl-3-fluorophenyl)boronic acid, 4-Acetyl-3-fluorobenzeneboronic acid, Boronic acid, (4-acetyl-3-fluorophenyl)-, (4-acetyl-3-fluoro-phenyl)boronic acid, 4-acetyl-3-fluorophenyl boronic acid, 4'-Borono-2'-fluoroacetophenone, YHEPWJRNHLTYSL-UHFFFAOYSA-N, 4-Acetyl-3-fluorophenylboronic acid (contains varying amounts of Anhydride)