CAS 947165-12-0 appears in our catalog under these names: 5-Fluoro-6-(hydroxymethyl)-1,3-dihydro-2,1-benzoxaborol-1-ol, 95%, 5-Fluoro-6-(hydroxymethyl)-1,3-dihydro-2,1-benzoxaborol-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol (CAS 947165-12-0) is a chemical compound with the molecular formula C8H8BFO3 and a molecular weight of 181.96 g/mol. IUPAC name: (5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol. InChIKey: CLDUWYKGTFMIOK-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO3 |
|---|---|
| Molecular weight | 181.96 g/mol |
| IUPAC name | (5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)methanol |
| InChIKey | CLDUWYKGTFMIOK-UHFFFAOYSA-N |
| SMILES | B1(C2=CC(=C(C=C2CO1)F)CO)O |
Computed by PubChem (NCBI)