CAS 99349-68-5 appears in our catalog under these names: 3–Acrylamidophenylboronic Acid (contains varying amounts of Anhydride), 3-Acrylamidophenylboronic Acid (contains varying amounts of Anhydride), 3-(ACRYLAMIDO)PHENYLBORONIC ACID, 98%, (3-Acrylamidophenyl)boronic acid, 98%, 98%, (3-Acrylamidophenyl)boronic acid, 95%. Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 250mg, 10g.
[3-(prop-2-enoylamino)phenyl]boronic acid (CAS 99349-68-5) is a chemical compound with the molecular formula C9H10BNO3 and a molecular weight of 190.99 g/mol. IUPAC name: [3-(prop-2-enoylamino)phenyl]boronic acid. InChIKey: ULVXDHIJOKEBMW-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO3 |
|---|---|
| Molecular weight | 190.99 g/mol |
| IUPAC name | [3-(prop-2-enoylamino)phenyl]boronic acid |
| InChIKey | ULVXDHIJOKEBMW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C=C)(O)O |
Computed by PubChem (NCBI)