Products 2096338-63-3
CAS 2096338-63-3 appears in our catalog under these names: 4-Cyano-3-ethoxyphenylboronic acid, 98%, 4-Cyano-3-ethoxyphenylboronic acid, 97%, (4-Cyano-3-ethoxyphenyl)boronic acid 97%, 4-Cyano-3-ethoxyphenylboronic acid, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g.
(4-cyano-3-ethoxyphenyl)boronic acid (CAS 2096338-63-3) is a chemical compound with the molecular formula C9H10BNO3 and a molecular weight of 190.99 g/mol. IUPAC name: (4-cyano-3-ethoxyphenyl)boronic acid. InChIKey: QYGXERVBFDZJNW-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO3 |
|---|---|
| Molecular weight | 190.99 g/mol |
| IUPAC name | (4-cyano-3-ethoxyphenyl)boronic acid |
| InChIKey | QYGXERVBFDZJNW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C#N)OCC)(O)O |
Computed by PubChem (NCBI)