Products 2377608-80-3
CAS 2377608-80-3 appears in our catalog under these names: (4-(Cyanomethyl)-3-methoxyphenyl)boronic acid, [4-(Cyanomethyl)-3-methoxyphenyl]boronic acid, 96%, (4-(Cyanomethyl)-3-methoxyphenyl)boronic acid, 96%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
[4-(cyanomethyl)-3-methoxyphenyl]boronic acid (CAS 2377608-80-3) is a chemical compound with the molecular formula C9H10BNO3 and a molecular weight of 190.99 g/mol. IUPAC name: [4-(cyanomethyl)-3-methoxyphenyl]boronic acid. InChIKey: DVTCEFSOCGCUDL-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO3 |
|---|---|
| Molecular weight | 190.99 g/mol |
| IUPAC name | [4-(cyanomethyl)-3-methoxyphenyl]boronic acid |
| InChIKey | DVTCEFSOCGCUDL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CC#N)OC)(O)O |
Computed by PubChem (NCBI)