CAS 1190875-38-7 appears in our catalog under these names: (2-Methyl-1-oxoisoindolin-5-yl)boronic acid, 95%, (2-Methyl-1-oxo-2,3-dihydro-1H-isoindol-5-yl)boronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
(2-methyl-1-oxo-3H-isoindol-5-yl)boronic acid (CAS 1190875-38-7) is a chemical compound with the molecular formula C9H10BNO3 and a molecular weight of 190.99 g/mol. IUPAC name: (2-methyl-1-oxo-3H-isoindol-5-yl)boronic acid. InChIKey: YGHVSQXEGJVZFG-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO3 |
|---|---|
| Molecular weight | 190.99 g/mol |
| IUPAC name | (2-methyl-1-oxo-3H-isoindol-5-yl)boronic acid |
| InChIKey | YGHVSQXEGJVZFG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=O)N(C2)C)(O)O |
Computed by PubChem (NCBI)