CAS 758697-66-4 appears in our catalog under these names: 2-Acrylamidophenylboronic acid, 97%, 2-Acrylamidophenylboronic Acid, (2-Acrylamidophenyl)boronic acid, 96% +(stabilized with TBC). Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
[2-(prop-2-enoylamino)phenyl]boronic acid (CAS 758697-66-4) is a chemical compound with the molecular formula C9H10BNO3 and a molecular weight of 190.99 g/mol. IUPAC name: [2-(prop-2-enoylamino)phenyl]boronic acid. InChIKey: XGDUBFMBDDZYKB-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO3 |
|---|---|
| Molecular weight | 190.99 g/mol |
| IUPAC name | [2-(prop-2-enoylamino)phenyl]boronic acid |
| InChIKey | XGDUBFMBDDZYKB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1NC(=O)C=C)(O)O |
Computed by PubChem (NCBI)