cas: 104775-65-7 — see every product listed under this CAS number, including other names
(3-Aminophenyl)(morpholino)methanone, ≥97%, ≥97% (CAS 104775-65-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118GKR-250mg |
| cas | 104775-65-7 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 434.00 Pln | |
| Chemat | 1g | 1086.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
(3-aminophenyl)-morpholin-4-ylmethanone (CAS 104775-65-7) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: (3-aminophenyl)-morpholin-4-ylmethanone. InChIKey: RFFVEVKGZGRRCP-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | (3-aminophenyl)-morpholin-4-ylmethanone |
| InChIKey | RFFVEVKGZGRRCP-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=O)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)