CAS 667437-07-2 is the registry number for 2-(2,3-Dihydro-1h-inden-5-yloxy)acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,3-dihydro-1H-inden-5-yloxy)acetohydrazide (CAS 667437-07-2) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-5-yloxy)acetohydrazide. InChIKey: QSYLSFHARIIARB-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-5-yloxy)acetohydrazide |
| InChIKey | QSYLSFHARIIARB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)OCC(=O)NN |
Computed by PubChem (NCBI)