CAS 15822-77-2 appears in our catalog under these names: 1-(2-Nitrophenyl)piperidine, 98%, 1-(2-Nitrophenyl)piperidine 98%, 1-(2-Nitrophenyl)piperidine, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 250mg.
1-(2-nitrophenyl)piperidine (CAS 15822-77-2) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 1-(2-nitrophenyl)piperidine. InChIKey: WDAUAKBDZSYXEM-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-(2-nitrophenyl)piperidine |
| InChIKey | WDAUAKBDZSYXEM-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)