CAS 1203499-66-4 is the registry number for 1-tert-Butyl-1h-pyrido[2,3-b][1,4]oxazin-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-tert-butylpyrido[2,3-b][1,4]oxazin-2-one (CAS 1203499-66-4) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 1-tert-butylpyrido[2,3-b][1,4]oxazin-2-one. InChIKey: NXHJESYEVATZBG-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-tert-butylpyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | NXHJESYEVATZBG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)COC2=C1C=CC=N2 |
Computed by PubChem (NCBI)