CAS 256397-59-8 appears in our catalog under these names: (S)-Methyl 5-amino-2,3-dihydro-1h-inden-2-ylcarbamate, 95%, (S)-Methyl 5-amino-2,3-dihydro-1H-inden-2-ylcarbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 5000mg, 1000mg.
Methyl N-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]carbamate (CAS 256397-59-8) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: methyl N-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]carbamate. InChIKey: OKQRQQGVLMVAKQ-JTQLQIEISA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | methyl N-[(2S)-5-amino-2,3-dihydro-1H-inden-2-yl]carbamate |
| InChIKey | OKQRQQGVLMVAKQ-JTQLQIEISA-N |
| SMILES | COC(=O)N[C@H]1CC2=C(C1)C=C(C=C2)N |
Computed by PubChem (NCBI)