cas: 1312765-69-7 — see every product listed under this CAS number, including other names
(3-Bromo-4-methylphenyl)boronic acid, 97% (CAS 1312765-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692472-1G |
| cas | 1312765-69-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1601.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3-bromo-4-methylphenyl)boronic acid (CAS 1312765-69-7) is a chemical compound with the molecular formula C7H8BBrO2 and a molecular weight of 214.85 g/mol. IUPAC name: (3-bromo-4-methylphenyl)boronic acid. InChIKey: VBESRPDPCSIDEN-UHFFFAOYSA-N.
| Molecular formula | C7H8BBrO2 |
|---|---|
| Molecular weight | 214.85 g/mol |
| IUPAC name | (3-bromo-4-methylphenyl)boronic acid |
| InChIKey | VBESRPDPCSIDEN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)Br)(O)O |
Computed by PubChem (NCBI)