cas: 31161-47-4 — see every product listed under this CAS number, including other names
(3-Bromophenyl)(thiophen-2-yl)methanone, 97%, 97% (CAS 31161-47-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BRH-250mg |
| cas | 31161-47-4 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 1590.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-bromophenyl)-thiophen-2-ylmethanone (CAS 31161-47-4) is a chemical compound with the molecular formula C11H7BrOS and a molecular weight of 267.14 g/mol. IUPAC name: (3-bromophenyl)-thiophen-2-ylmethanone. InChIKey: RQQDVYVFIYKWNT-UHFFFAOYSA-N.
| Molecular formula | C11H7BrOS |
|---|---|
| Molecular weight | 267.14 g/mol |
| IUPAC name | (3-bromophenyl)-thiophen-2-ylmethanone |
| InChIKey | RQQDVYVFIYKWNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)