CAS 1385694-70-1 appears in our catalog under these names: 2-(4-Bromophenyl)-2-(isobutyryloxy)acetic acid, 95%, 2-(4-Bromophenyl)-2-(isobutyryloxy)acetic acid, 95+%, 2–(4–Bromophenyl)–2–(isobutyryloxy)acetic Acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 50mg.
(3-bromophenyl)-thiophen-2-ylmethanone (CAS 1385694-70-1) is a chemical compound with the molecular formula C11H7BrOS and a molecular weight of 267.14 g/mol. IUPAC name: (3-bromophenyl)-thiophen-2-ylmethanone. InChIKey: RQQDVYVFIYKWNT-UHFFFAOYSA-N.
| Molecular formula | C11H7BrOS |
|---|---|
| Molecular weight | 267.14 g/mol |
| IUPAC name | (3-bromophenyl)-thiophen-2-ylmethanone |
| InChIKey | RQQDVYVFIYKWNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)