CAS 934570-51-1 is the registry number for 4-(3-Bromothien-2-yl)benzaldehyde, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
4-(3-bromothiophen-2-yl)benzaldehyde (CAS 934570-51-1) is a chemical compound with the molecular formula C11H7BrOS and a molecular weight of 267.14 g/mol. IUPAC name: 4-(3-bromothiophen-2-yl)benzaldehyde. InChIKey: BTYZFUJFFBNJTP-UHFFFAOYSA-N.
| Molecular formula | C11H7BrOS |
|---|---|
| Molecular weight | 267.14 g/mol |
| IUPAC name | 4-(3-bromothiophen-2-yl)benzaldehyde |
| InChIKey | BTYZFUJFFBNJTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=C(C=CS2)Br |
Computed by PubChem (NCBI)