CAS 886509-00-8 is the registry number for 5-(2-Bromophenyl)thiophene-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-(2-bromophenyl)thiophene-2-carbaldehyde (CAS 886509-00-8) is a chemical compound with the molecular formula C11H7BrOS and a molecular weight of 267.14 g/mol. IUPAC name: 5-(2-bromophenyl)thiophene-2-carbaldehyde. InChIKey: IQUYPNNYNSJOEJ-UHFFFAOYSA-N.
| Molecular formula | C11H7BrOS |
|---|---|
| Molecular weight | 267.14 g/mol |
| IUPAC name | 5-(2-bromophenyl)thiophene-2-carbaldehyde |
| InChIKey | IQUYPNNYNSJOEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(S2)C=O)Br |
Computed by PubChem (NCBI)