CAS 1138326-95-0 appears in our catalog under these names: 5-Bromo-4-phenylthiophene-2-carbaldehyde, ≥95%, ≥95%, 5-Bromo-4-phenylthiophene-2-carbaldehyde, 95%. Offered by: Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 5g, 1g.
5-bromo-4-phenylthiophene-2-carbaldehyde (CAS 1138326-95-0) is a chemical compound with the molecular formula C11H7BrOS and a molecular weight of 267.14 g/mol. IUPAC name: 5-bromo-4-phenylthiophene-2-carbaldehyde. InChIKey: ZMAPHWPOKXUIHE-UHFFFAOYSA-N.
| Molecular formula | C11H7BrOS |
|---|---|
| Molecular weight | 267.14 g/mol |
| IUPAC name | 5-bromo-4-phenylthiophene-2-carbaldehyde |
| InChIKey | ZMAPHWPOKXUIHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=C2)C=O)Br |
Computed by PubChem (NCBI)