cas: 849062-15-3 — see every product listed under this CAS number, including other names
(3-Butoxy-2,6-difluorophenyl)boronic acid 98% (CAS 849062-15-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A353625-250mg |
| cas | 849062-15-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1277.06 Pln | |
| Ambeed | 25g | 4286.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A353625 |
(3-butoxy-2,6-difluorophenyl)boronic acid (CAS 849062-15-3) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (3-butoxy-2,6-difluorophenyl)boronic acid. InChIKey: LWJYMUNYLKIETN-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | (3-butoxy-2,6-difluorophenyl)boronic acid |
| InChIKey | LWJYMUNYLKIETN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCCCC)F)(O)O |
Computed by PubChem (NCBI)