Products 2096339-89-6
CAS 2096339-89-6 is the registry number for 2,4-Difluoro-3-isobutoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
[2,4-difluoro-3-(2-methylpropoxy)phenyl]boronic acid (CAS 2096339-89-6) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: [2,4-difluoro-3-(2-methylpropoxy)phenyl]boronic acid. InChIKey: AEKLDTDSAOTINS-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | [2,4-difluoro-3-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | AEKLDTDSAOTINS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OCC(C)C)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Difluoro-3-isobutoxyphenylboronic acid, (2,4-Difluoro-3-isobutoxyphenyl)boronic acid, [2,4-difluoro-3-(2-methylpropoxy)phenyl]boronic acid, (2,4-Difluoro-3-isobutoxyphenyl)boronicacid, (2,4-difluoro-3-isobutoxy-phenyl)boronic acid, Boronic acid, B-[2,4-difluoro-3-(2-methylpropoxy)phenyl]-