Products 2096333-61-6
CAS 2096333-61-6 is the registry number for 2,4-Difluoro-5-methyl-3-propoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
(2,4-difluoro-5-methyl-3-propoxyphenyl)boronic acid (CAS 2096333-61-6) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (2,4-difluoro-5-methyl-3-propoxyphenyl)boronic acid. InChIKey: QUDWBJCLUWCROZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | (2,4-difluoro-5-methyl-3-propoxyphenyl)boronic acid |
| InChIKey | QUDWBJCLUWCROZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OCCC)F)C)(O)O |
Computed by PubChem (NCBI)