Products 2096339-90-9

CAS 2096339-90-9 appears in our catalog under these names: 2,4-Difluoro-3-isopropoxy-5-methylphenylboronic acid, 97%, (2,4-Difluoro-3-isopropoxy-5-methylphenyl)boronic acid 97%, 2,4-Difluoro-3-isopropoxy-5-methylphenylboronic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(2,4-difluoro-5-methyl-3-propan-2-yloxyphenyl)boronic acid (CAS 2096339-90-9) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (2,4-difluoro-5-methyl-3-propan-2-yloxyphenyl)boronic acid. InChIKey: CJYRRWCWAJPESW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13BF2O3
Molecular weight230.02 g/mol
IUPAC name(2,4-difluoro-5-methyl-3-propan-2-yloxyphenyl)boronic acid
InChIKeyCJYRRWCWAJPESW-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1F)OC(C)C)F)C)(O)O

Computed by PubChem (NCBI)