CAS 2096329-70-1 is the registry number for 3-Butoxy-2,4-difluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
(3-butoxy-2,4-difluorophenyl)boronic acid (CAS 2096329-70-1) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (3-butoxy-2,4-difluorophenyl)boronic acid. InChIKey: XLQMUWAHCITXBG-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | (3-butoxy-2,4-difluorophenyl)boronic acid |
| InChIKey | XLQMUWAHCITXBG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)OCCCC)F)(O)O |
Computed by PubChem (NCBI)