cas: 279261-81-3 — see every product listed under this CAS number, including other names
(3-Chloro-4-ethoxyphenyl)boronic acid 98% (CAS 279261-81-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A744936-1g |
| cas | 279261-81-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 476.06 Pln | |
| Ambeed | 100g | 1683.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A744936 |
(3-chloro-4-ethoxyphenyl)boronic acid (CAS 279261-81-3) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (3-chloro-4-ethoxyphenyl)boronic acid. InChIKey: QZMQZKMQXURQNC-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (3-chloro-4-ethoxyphenyl)boronic acid |
| InChIKey | QZMQZKMQXURQNC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC)Cl)(O)O |
Computed by PubChem (NCBI)