CAS 511295-09-3 appears in our catalog under these names: 5-Chloro-4-methoxy-2-methylphenylboronic acid, 98%, (5-Chloro-4-methoxy-2-methylphenyl)boronic acid, 98%, 5-Chloro-4-methoxy-2-methylphenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(5-chloro-4-methoxy-2-methylphenyl)boronic acid (CAS 511295-09-3) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (5-chloro-4-methoxy-2-methylphenyl)boronic acid. InChIKey: RYCISTVGQKCVHG-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (5-chloro-4-methoxy-2-methylphenyl)boronic acid |
| InChIKey | RYCISTVGQKCVHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)OC)Cl)(O)O |
Computed by PubChem (NCBI)