Products 279261-81-3
CAS 279261-81-3 appears in our catalog under these names: 3-Chloro-4-ethoxyphenylboronic acid, 98%, 3-Chloro-4-ethoxyphenylboronic acid, 98%, 98%, (3-Chloro-4-ethoxyphenyl)boronic acid, 98%, 3–Chloro–4–ethoxyphenylboronic Acid (contains varying amounts of Anhydride), 3-Chloro-4-ethoxyphenylboronic Acid (contains varying amounts of Anhydride). Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed, GLPBio. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 250mg.
(3-chloro-4-ethoxyphenyl)boronic acid (CAS 279261-81-3) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (3-chloro-4-ethoxyphenyl)boronic acid. InChIKey: QZMQZKMQXURQNC-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (3-chloro-4-ethoxyphenyl)boronic acid |
| InChIKey | QZMQZKMQXURQNC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-4-ethoxyphenylboronic acid, 3-Chloro-4-ethoxybenzeneboronic acid, (3-Chloro-4-ethoxyphenyl)boronic acid, Boronic acid, (3-chloro-4-ethoxyphenyl)-, 3-Chloro-4-ethoxyphenylboronic acid (contains varying amounts of Anhydride), (3-chloro-4-ethoxy-phenyl)boronic Acid, 3-Chloro-4-ethoxypheylboronic acid, (3-Chloro-4-ethoxyphenyl)boronicacid