CAS 900174-62-1 appears in our catalog under these names: 4-Chloro-3-ethoxyphenylboronic acid, 98%, (4-Chloro-3-ethoxyphenyl)boronic acid, 98%, 98%, (4-Chloro-3-ethoxyphenyl)boronic acid, 98%, (4-Chloro-3-ethoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg.
(4-chloro-3-ethoxyphenyl)boronic acid (CAS 900174-62-1) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (4-chloro-3-ethoxyphenyl)boronic acid. InChIKey: WYEAKFIRTXVYNS-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (4-chloro-3-ethoxyphenyl)boronic acid |
| InChIKey | WYEAKFIRTXVYNS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)OCC)(O)O |
Computed by PubChem (NCBI)