CAS 2096335-81-6 appears in our catalog under these names: 2-Chloro-5-methoxy-4-methylbenzeneboronic acid, 96%, 2–Chloro–5–methoxy–4–methylphenylboronic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 25mg.
(2-chloro-5-methoxy-4-methylphenyl)boronic acid (CAS 2096335-81-6) is a chemical compound with the molecular formula C8H10BClO3 and a molecular weight of 200.43 g/mol. IUPAC name: (2-chloro-5-methoxy-4-methylphenyl)boronic acid. InChIKey: SGXKFHANCRFZQV-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO3 |
|---|---|
| Molecular weight | 200.43 g/mol |
| IUPAC name | (2-chloro-5-methoxy-4-methylphenyl)boronic acid |
| InChIKey | SGXKFHANCRFZQV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)C)OC)(O)O |
Computed by PubChem (NCBI)