cas: 175277-74-4 — see every product listed under this CAS number, including other names
(3-Chloro-5-(trifluoromethyl)pyridin-2-yl)methanamine, 98+% (CAS 175277-74-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A265412-5g |
| cas | 175277-74-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9008.23 Pln | |
| AmBeed | 10g | 14964.88 Pln | |
| AmBeed | 100mg | 981.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methanamine (CAS 175277-74-4) is a chemical compound with the molecular formula C7H6ClF3N2 and a molecular weight of 210.58 g/mol. IUPAC name: [3-chloro-5-(trifluoromethyl)-2-pyridinyl]methanamine. InChIKey: JVQYWHGODHSTAM-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2 |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | [3-chloro-5-(trifluoromethyl)-2-pyridinyl]methanamine |
| InChIKey | JVQYWHGODHSTAM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)CN)C(F)(F)F |
Computed by PubChem (NCBI)